CAS 897086-95-2
:3-(Phenylmethoxy)-azetidine
Description:
3-(Phenylmethoxy)-azetidine is a chemical compound characterized by its azetidine ring, which is a four-membered saturated heterocyclic structure containing one nitrogen atom. The presence of a phenylmethoxy group indicates that a phenyl group is attached to a methoxy (-O-CH2-) moiety, which is further linked to the azetidine ring. This compound may exhibit properties typical of azetidines, such as being a potential building block in organic synthesis and medicinal chemistry due to its ability to participate in various chemical reactions. The presence of the phenylmethoxy substituent can influence its solubility, reactivity, and biological activity. Additionally, compounds like this may be explored for their potential pharmacological applications, including roles as intermediates in drug development. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C10H13NO
InChI:InChI=1S/C10H13NO/c1-2-4-9(5-3-1)8-12-10-6-11-7-10/h1-5,10-11H,6-8H2
InChI key:InChIKey=FJVSSNCNHKAMHI-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2CNC2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.