CAS 897086-96-3

Azetidine, 3-[(4-chlorophenyl)methoxy]-

Description:

Azetidine, 3-[(4-chlorophenyl)methoxy]- is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of a 4-chlorophenyl group indicates that there is a chlorinated phenyl moiety attached to the azetidine at the 3-position, linked via a methoxy group. This substitution can influence the compound's reactivity, solubility, and biological activity. The methoxy group enhances the lipophilicity of the molecule, potentially affecting its pharmacokinetic properties. Azetidine derivatives are of interest in medicinal chemistry due to their potential applications in drug development, particularly in the treatment of various diseases. The specific characteristics of this compound, such as its melting point, boiling point, and spectral data, would typically be determined through experimental methods. Additionally, safety and handling information would be essential for laboratory work involving this substance, as with any chemical compound.

Formula: C₁₀H₁₂ClNO

InChI: InChI=1S/C10H12ClNO/c11-9-3-1-8(2-4-9)7-13-10-5-12-6-10/h1-4,10,12H,5-7H2

InChI key: InChIKey=JZNJIWGJZHPTBV-UHFFFAOYSA-N

SMILES: C(OC1CNC1)C2=CC=C(Cl)C=C2

Synonyms:

• Azetidine, 3-[(4-chlorophenyl)methoxy]-
• 3-[(4-Chlorophenyl)methoxy]azetidine
• 3-[(4-Chlorobenzyl)oxy]azetidine