CAS 897094-28-9

1-[(2-Chloro-6-fluorophenyl)methyl]-4-piperidinecarboxylic acid

Description:

1-[(2-Chloro-6-fluorophenyl)methyl]-4-piperidinecarboxylic acid, with the CAS number 897094-28-9, is a chemical compound characterized by its piperidine structure, which features a carboxylic acid functional group. This compound contains a chloro and a fluorine substituent on the aromatic ring, contributing to its unique chemical properties and potential biological activity. The presence of the piperidine moiety suggests that it may exhibit properties typical of piperidine derivatives, such as potential interactions with neurotransmitter systems. The compound is likely to be a solid at room temperature, with solubility influenced by the carboxylic acid group, which can engage in hydrogen bonding. Its molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. As with many compounds containing halogens, it may also exhibit specific reactivity patterns, making it of interest for further chemical synthesis and study. Safety and handling precautions should be observed due to the presence of chlorine and fluorine atoms, which can impart toxicity or environmental concerns.

Formula: C₁₃H₁₅ClFNO₂

InChI: InChI=1S/C13H15ClFNO2/c14-11-2-1-3-12(15)10(11)8-16-6-4-9(5-7-16)13(17)18/h1-3,9H,4-8H2,(H,17,18)

InChI key: InChIKey=IJGJNKGYWAWVFJ-UHFFFAOYSA-N

SMILES: C(C1=C(Cl)C=CC=C1F)N2CCC(C(O)=O)CC2

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[(2-chloro-6-fluorophenyl)methyl]-
• 1-[(2-Chloro-6-fluorophenyl)methyl]-4-piperidinecarboxylic acid