CAS 897094-33-6
:1-Cyclohexyl-4-piperidinecarboxylic acid
Description:
1-Cyclohexyl-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a cyclohexyl group and a piperidine ring, along with a carboxylic acid functional group. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may exhibit biological activity related to its piperidine moiety. The presence of the cyclohexyl group can influence the compound's lipophilicity, potentially affecting its pharmacokinetic properties. Additionally, the compound's acidity can be relevant in various chemical reactions and interactions. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles. Overall, 1-Cyclohexyl-4-piperidinecarboxylic acid represents a versatile structure with potential implications in drug design and synthesis.
Formula:C12H21NO2
InChI:InChI=1S/C12H21NO2/c14-12(15)10-6-8-13(9-7-10)11-4-2-1-3-5-11/h10-11H,1-9H2,(H,14,15)
InChI key:InChIKey=QTJYMJZSIMYYLB-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCN(CC1)C2CCCCC2
Synonyms:- 4-Piperidinecarboxylic acid, 1-cyclohexyl-
- 1-Cyclohexylpiperidin-1-ium-4-carboxylate
- 1-Cyclohexyl-4-piperidinecarboxylic acid
- 1-cyclohexylpiperidine-4-carboxylic acid
- 1-Cyclohexyl-4-piperidinecarboxylic acid hydrochloride
- 1-CYCLOHEXYLPIPERIDINE-4-CARBOXYLIC ACIDHYDROCHLORIDE
- 1-cyclohexylisonipecotic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.