CAS 897094-34-7
:1-(Tetrahydro-3-thienyl)-4-piperidinecarboxylic acid
Description:
1-(Tetrahydro-3-thienyl)-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a tetrahydrothienyl group. This compound features a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity. The presence of the tetrahydrothienyl moiety suggests that it may exhibit interesting biological activities, possibly related to its interaction with various receptors or enzymes. The compound's molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders. Its solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest for further research. Additionally, the compound's CAS number, 897094-34-7, serves as a unique identifier for regulatory and safety information, facilitating its study and application in various scientific fields. Overall, this compound represents a fascinating area of exploration in organic and medicinal chemistry.
Formula:C10H17NO2S
InChI:InChI=1S/C10H17NO2S/c12-10(13)8-1-4-11(5-2-8)9-3-6-14-7-9/h8-9H,1-7H2,(H,12,13)
InChI key:InChIKey=VTGUCXMBTHVZAF-UHFFFAOYSA-N
SMILES:C(O)(=O)C1CCN(CC1)C2CCSC2
Synonyms:- 4-Piperidinecarboxylic acid, 1-(tetrahydro-3-thienyl)-
- 1-(Tetrahydro-3-thienyl)-4-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.