CAS 89713-95-1

Methanaminium, 1-carboxy-N,N,N-trimethyl-, hexanedioate (2:1)

Description:

Methanaminium, 1-carboxy-N,N,N-trimethyl-, hexanedioate (2:1), with CAS number 89713-95-1, is an organic compound characterized by its quaternary ammonium structure, which includes a trimethylammonium group and a carboxylate moiety. This compound typically exhibits properties associated with both ionic and polar characteristics due to the presence of charged functional groups. It is likely to be soluble in polar solvents, such as water, owing to its ionic nature. The hexanedioate component suggests that it may participate in various chemical reactions, including esterification and salt formation. Additionally, the presence of the trimethylammonium group can impart surfactant properties, making it potentially useful in applications such as emulsification or as a phase transfer catalyst. The compound may also exhibit biological activity, which could be relevant in pharmaceutical or agricultural contexts. Overall, its unique structural features contribute to its potential utility in various chemical and industrial applications.

Formula: C₆H₈O₄·2C₅H₁₂NO₂

InChI: InChI=1S/C6H10O4.C5H11NO2/c7-5(8)3-1-2-4-6(9)10;1-6(2,3)4-5(7)8/h1-4H2,(H,7,8)(H,9,10);4H2,1-3H3/p-1

InChI key: InChIKey=DDJMECVGLGFKEN-UHFFFAOYSA-M

SMILES: C([N+](C)(C)C)C(O)=O.C(CCC([O-])=O)CC([O-])=O

Synonyms:

• Bis((carboxymethyl)trimethylammonium) adipate
• Bis[(carboxymethyl)trimethylammonium] adipate
• hexanedioate
• Hexanedioic acid, ion(2-), bis(1-carboxy-N,N,N-trimethylmethanaminium)
• carboxymethyl-trimethyl-ammonium
• Methanaminium, 1-carboxy-N,N,N-trimethyl-, hexanedioate (2:1)

Bis((carboxymethyl)trimethylammonium) adipate

CAS: 89713-95-1

Formula: C₁₆H₃₂N₂O₈

Molecular weight: 380.4339

Ref: IN-DA0043VZ