
CAS 89718-60-5
:2,3-Dihydro-2-(2-methyl-2-nitropropyl)-1H-inden-1-one
Description:
2,3-Dihydro-2-(2-methyl-2-nitropropyl)-1H-inden-1-one, with the CAS number 89718-60-5, is an organic compound characterized by its unique structure, which includes an indene core modified by a dihydro group and a nitro-substituted alkyl chain. This compound typically exhibits a yellow to brown color and is likely to be a solid at room temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of various chemical products. The presence of the nitro group suggests that it may participate in electrophilic reactions, while the indene structure can contribute to its reactivity and stability. Additionally, the compound's properties, such as solubility and melting point, can vary based on the specific conditions and purity. Safety data should be consulted, as nitro compounds can be sensitive and may pose health risks. Overall, 2,3-Dihydro-2-(2-methyl-2-nitropropyl)-1H-inden-1-one is a compound of interest in both academic and industrial chemistry contexts.
Formula:C13H15NO3
InChI:InChI=1S/C13H15NO3/c1-13(2,14(16)17)8-10-7-9-5-3-4-6-11(9)12(10)15/h3-6,10H,7-8H2,1-2H3
InChI key:InChIKey=SIBWLMCNCLMZLB-UHFFFAOYSA-N
SMILES:O=C1C=2C(CC1CC(N(=O)=O)(C)C)=CC=CC2
Synonyms:- 2-(2′-Methyl-2′-nitropropyl)indan-1-one
- 1H-Inden-1-one, 2,3-dihydro-2-(2-methyl-2-nitropropyl)-
- 2,3-Dihydro-2-(2-methyl-2-nitropropyl)-1H-inden-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Inden-1-one, 2,3-dihydro-2-(2-methyl-2-nitropropyl)-
CAS:Formula:C13H15NO3Molecular weight:233.2631
