CAS 89719-92-6

2,5-Dichloro-4-(trifluoromethyl)pyridine

Description:

2,5-Dichloro-4-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 2 and 5 positions with chlorine atoms and at the 4 position with a trifluoromethyl group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its relatively high stability and low volatility, making it suitable for various applications in the chemical industry, particularly in the synthesis of agrochemicals and pharmaceuticals. The presence of chlorine and trifluoromethyl groups enhances its reactivity and lipophilicity, which can influence its biological activity and environmental behavior. Additionally, 2,5-Dichloro-4-(trifluoromethyl)pyridine may exhibit specific toxicological properties, necessitating careful handling and adherence to safety protocols during its use. Its unique structure and functional groups contribute to its utility in chemical synthesis and research.

Formula: C₆H₂Cl₂F₃N

InChI: InChI=1S/C6H2Cl2F3N/c7-4-2-12-5(8)1-3(4)6(9,10)11/h1-2H

InChI key: InChIKey=GFTRYJQAASFSIB-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C(Cl)=CN=C(Cl)C1

Synonyms:

• 2,5-Dichloro-4-(trifluoromethyl)pyridine
• Pyridine, 2,5-dichloro-4-(trifluoromethyl)-

2,5-Dichloro-4-(trifluoromethyl)pyridine, 97%

CAS: 89719-92-6

2-chloro-6-(trifluoromethyl)pyridine, 2-chloro-5-(trifluoromethyl)pyridine and 3-chloro-4-(trifluoromethyl)pyridine were each converted into the three possible carboxylic acids 2, 4, 6,8, 10, 12, 16, 17 and 20. This was achieved by employing several, but not all of the organometallic toolbox methods

Formula: C₆H₂Cl₂F₃N

Purity: 97%

Color and Shape: Clear pale yellow, Liquid

Molecular weight: 215.99

Ref: 02-H33442

2,5-dichloro-4-(trifluoromethyl)pyridine

CAS: 89719-92-6

Formula: C₆H₂Cl₂F₃N

Purity: 96%

Color and Shape: Liquid

Molecular weight: 215.9880

Ref: IN-DA0042B6

2,5-Dichloro-4-(trifluoromethyl)pyridine

CAS: 89719-92-6

2,5-Dichloro-4-(trifluoromethyl)pyridine

Purity: 97%

Color and Shape: Liquid

Molecular weight: 215.99g/mol

Ref: 54-PC7264

2,5-Dichloro-4-trifluoromethylpyridine

CAS: 89719-92-6

Formula: C₆H₂Cl₂F₃N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 215.98

Ref: 10-F069666

2,5-Dichloro-4-(trifluoromethyl)pyridine

CAS: 89719-92-6

Versatile small molecule scaffold

Formula: C₆H₂Cl₂F₃N

Purity: Min. 95%

Molecular weight: 215.99 g/mol

Ref: 3D-PDA71992