CAS 89724-35-6

[5-methyl-2-(1-methylcyclohexyl)-1,3-oxazol-4-yl]acetic acid

Description:

[5-methyl-2-(1-methylcyclohexyl)-1,3-oxazol-4-yl]acetic acid, with the CAS number 89724-35-6, is a chemical compound characterized by its oxazole ring structure, which contributes to its unique reactivity and properties. This compound features a methyl group and a 1-methylcyclohexyl substituent, enhancing its hydrophobic characteristics. The presence of the acetic acid functional group indicates that it can participate in acid-base reactions, making it a potential candidate for various chemical syntheses and applications. Its oxazole moiety may also impart biological activity, suggesting potential uses in pharmaceuticals or agrochemicals. The compound's molecular structure allows for various interactions, including hydrogen bonding and van der Waals forces, which can influence its solubility and stability in different solvents. Overall, [5-methyl-2-(1-methylcyclohexyl)-1,3-oxazol-4-yl]acetic acid is a versatile compound with potential applications in organic synthesis and medicinal chemistry, although specific biological activities and reactivity would require further investigation.

Formula: C₁₃H₁₉NO₃

InChI: InChI=1/C13H19NO3/c1-9-10(8-11(15)16)14-12(17-9)13(2)6-4-3-5-7-13/h3-8H2,1-2H3,(H,15,16)

Synonyms:

• 4-oxazoleacetic acid, 5-methyl-2-(1-methylcyclohexyl)-

4-Oxazoleacetic acid,5-methyl-2-(1-methylcyclohexyl)-

CAS: 89724-35-6

Formula: C₁₃H₁₉NO₃

Molecular weight: 237.2949

Ref: IN-DA00430R