CymitQuimica logo

CAS 89730-31-4

:

2-(3-Octen-1-yl)benzoic acid

Description:
2-(3-Octen-1-yl)benzoic acid is an organic compound characterized by its unique structure, which features a benzoic acid moiety attached to a long-chain alkenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, including moderate solubility in organic solvents and limited solubility in water due to its hydrophobic alkyl chain. The presence of the carboxylic acid functional group imparts acidic characteristics, allowing it to participate in various chemical reactions, such as esterification and amidation. The alkenyl chain contributes to its potential reactivity, particularly in addition reactions. Additionally, this compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry and materials science. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled.
Formula:C15H20O2
InChI:InChI=1S/C15H20O2/c1-2-3-4-5-6-7-10-13-11-8-9-12-14(13)15(16)17/h5-6,8-9,11-12H,2-4,7,10H2,1H3,(H,16,17)
InChI key:InChIKey=HPYRXQXUICKSIJ-UHFFFAOYSA-N
SMILES:C(CC=CCCCC)C1=C(C(O)=O)C=CC=C1
Synonyms:
  • 2-(3-Octenyl)benzoic acid
  • Benzoic acid, 2-(3-octen-1-yl)-
  • 2-(3-Octen-1-yl)benzoic acid
  • Benzoic acid, 2-(3-octenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.