
CAS 89731-82-8
:N-(3,4-Dichlorophenyl)-2,3-dihydro-1H-indole-1-carboxamide
Description:
N-(3,4-Dichlorophenyl)-2,3-dihydro-1H-indole-1-carboxamide, with the CAS number 89731-82-8, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features a dichlorophenyl group, indicating the presence of two chlorine atoms on the phenyl ring, which can significantly influence its biological activity and chemical reactivity. The carboxamide functional group contributes to its potential as a pharmacological agent, as it can participate in hydrogen bonding and affect solubility and stability. The compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests that it may exhibit interesting interactions with biological targets, making it a subject of interest in drug discovery and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C15H12Cl2N2O
InChI:InChI=1S/C15H12Cl2N2O/c16-12-6-5-11(9-13(12)17)18-15(20)19-8-7-10-3-1-2-4-14(10)19/h1-6,9H,7-8H2,(H,18,20)
InChI key:InChIKey=RIMYKURWPJPYDI-UHFFFAOYSA-N
SMILES:C(NC1=CC(Cl)=C(Cl)C=C1)(=O)N2C=3C(CC2)=CC=CC3
Synonyms:- N-(3,4-Dichlorophenyl)-2,3-dihydro-1H-indole-1-carboxamide
- 1H-Indole-1-carboxamide, N-(3,4-dichlorophenyl)-2,3-dihydro-
- 2,3-Dihydro-indole-1-carboxylic acid (3,4-dichloro-phenyl)-amide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Indole-1-carboxamide, N-(3,4-dichlorophenyl)-2,3-dihydro-
CAS:Formula:C15H12Cl2N2OMolecular weight:307.1746
