CymitQuimica logo

CAS 89732-20-7

:

1-Azaspiro[4.5]decan-4-amine, 1-methyl-, (2E)-2-butenedioate (1:2)

Description:
1-Azaspiro[4.5]decan-4-amine, 1-methyl-, (2E)-2-butenedioate (1:2), with CAS number 89732-20-7, is a chemical compound characterized by its unique spirocyclic structure, which includes a nitrogen atom in a bicyclic framework. This compound features an amine functional group, contributing to its potential reactivity and interaction with other chemical species. The presence of the (2E)-2-butenedioate moiety indicates that it contains a conjugated system, which may impart specific electronic properties and influence its reactivity. The spiro configuration often leads to interesting stereochemical properties, which can affect the compound's biological activity and solubility. Additionally, the compound may exhibit various physical properties such as melting and boiling points, solubility in different solvents, and stability under various conditions. Its applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific interactions and properties. Further studies would be necessary to fully elucidate its behavior and potential uses in various fields.
Formula:C10H20N2·2C4H4O4
InChI:InChI=1S/C10H20N2.C4H4O4/c1-12-8-5-9(11)10(12)6-3-2-4-7-10;5-3(6)1-2-4(7)8/h9H,2-8,11H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+
InChI key:InChIKey=KNCQCDUXZBBJSK-WLHGVMLRSA-N
SMILES:NC1C2(N(C)CC1)CCCCC2.C(=C/C(O)=O)\C(O)=O
Synonyms:
  • 1-Azaspiro[4.5]decan-4-amine, 1-methyl-, (E)-2-butenedioate (1:2)
  • 1-Azaspiro[4.5]decan-4-amine, 1-methyl-, (2E)-2-butenedioate (1:2)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.