CymitQuimica logo

CAS 89733-05-1

:

1-[4-[(4-Fluorophenyl)thio]-3-nitrophenyl]-1-butanone

Description:
1-[4-[(4-Fluorophenyl)thio]-3-nitrophenyl]-1-butanone, with the CAS number 89733-05-1, is an organic compound characterized by its complex structure, which includes a butanone moiety linked to a phenyl group that is further substituted with a fluorophenyl and a nitrophenyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential polarity due to the presence of the nitro group and the sulfur atom in the thioether linkage. The fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity or altering its solubility in various solvents. Additionally, the nitro group is known for its electron-withdrawing effects, which can affect the compound's reactivity in electrophilic aromatic substitution reactions. Overall, this compound may be of interest in various fields, including medicinal chemistry and materials science, due to its unique structural features and potential biological activities.
Formula:C16H14FNO3S
InChI:InChI=1S/C16H14FNO3S/c1-2-3-15(19)11-4-9-16(14(10-11)18(20)21)22-13-7-5-12(17)6-8-13/h4-10H,2-3H2,1H3
InChI key:InChIKey=UDXAXLDSYPZRNT-UHFFFAOYSA-N
SMILES:S(C1=C(N(=O)=O)C=C(C(CCC)=O)C=C1)C2=CC=C(F)C=C2
Synonyms:
  • 1-Butanone, 1-[4-[(4-fluorophenyl)thio]-3-nitrophenyl]-
  • 1-[4-[(4-Fluorophenyl)thio]-3-nitrophenyl]-1-butanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.