CAS 89735-30-8
:4-Fluoro-5-(hydroxymethyl)-1,2-benzenediol
Description:
4-Fluoro-5-(hydroxymethyl)-1,2-benzenediol, with the CAS number 89735-30-8, is an organic compound characterized by the presence of a fluorine atom and two hydroxymethyl groups attached to a benzene ring. This compound features a dihydroxybenzene structure, which contributes to its potential reactivity and solubility in polar solvents. The fluorine substituent can influence the compound's electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. The hydroxymethyl groups provide sites for further functionalization, making it a versatile intermediate in organic synthesis. Additionally, the presence of hydroxyl groups may impart hydrogen bonding capabilities, affecting its physical properties such as boiling point and solubility. This compound may have applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex organic molecules. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate any potential hazards associated with its use.
Formula:C7H7FO3
InChI:InChI=1S/C7H7FO3/c8-5-2-7(11)6(10)1-4(5)3-9/h1-2,9-11H,3H2
InChI key:InChIKey=RMVVYWAHGBJBTI-UHFFFAOYSA-N
SMILES:C(O)C1=C(F)C=C(O)C(O)=C1
Synonyms:- 3,4-Dihydroxy-6-fluorobenzyl alcohol
- 1,2-Benzenediol, 4-fluoro-5-(hydroxymethyl)-
- 4-Fluoro-5-(hydroxymethyl)-1,2-benzenediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
