
CAS 89735-66-0
:N-[4-(2-Bromoacetyl)phenyl]hexadecanamide
Description:
N-[4-(2-Bromoacetyl)phenyl]hexadecanamide, with the CAS number 89735-66-0, is an organic compound characterized by its amide functional group, which is formed from the reaction of a carboxylic acid and an amine. This compound features a hexadecanamide backbone, indicating a long-chain fatty acid derivative, which contributes to its hydrophobic properties. The presence of the 2-bromoacetyl group attached to a phenyl ring introduces both electrophilic and steric characteristics, making it potentially reactive in various chemical reactions. The bromine atom can serve as a leaving group in nucleophilic substitution reactions, while the phenyl ring can participate in π-π stacking interactions, influencing the compound's solubility and stability. Additionally, the long hydrophobic tail may enhance its ability to interact with lipid membranes, suggesting potential applications in drug delivery or as a surfactant. Overall, the unique structural features of this compound may lead to interesting biological activities and chemical reactivity, warranting further investigation in both synthetic and medicinal chemistry contexts.
Formula:C24H38BrNO2
InChI:InChI=1S/C24H38BrNO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-24(28)26-22-18-16-21(17-19-22)23(27)20-25/h16-19H,2-15,20H2,1H3,(H,26,28)
InChI key:InChIKey=IAZAOYJQCZJALJ-UHFFFAOYSA-N
SMILES:N(C(CCCCCCCCCCCCCCC)=O)C1=CC=C(C(CBr)=O)C=C1
Synonyms:- Hexadecanamide, N-[4-(2-bromoacetyl)phenyl]-
- N-[4-(2-Bromoacetyl)phenyl]hexadecanamide
- Hexadecanamide, N-[4-(bromoacetyl)phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
