CymitQuimica logo

CAS 897360-17-7

:

6-Chloro-4-(1-piperazinyl)pyrido[3,2-d]pyrimidine

Description:
6-Chloro-4-(1-piperazinyl)pyrido[3,2-d]pyrimidine is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. The presence of a chlorine atom at the 6-position and a piperazine moiety at the 4-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the piperazine group, which can engage in hydrogen bonding. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may also display specific reactivity patterns typical of halogenated heterocycles, such as electrophilic substitution or nucleophilic attack, depending on the reaction conditions. Overall, 6-Chloro-4-(1-piperazinyl)pyrido[3,2-d]pyrimidine is a compound of interest for further research in drug discovery and development.
Formula:C11H12ClN5
InChI:InChI=1S/C11H12ClN5/c12-9-2-1-8-10(16-9)11(15-7-14-8)17-5-3-13-4-6-17/h1-2,7,13H,3-6H2
InChI key:InChIKey=HPKTYMDQKLMUOX-UHFFFAOYSA-N
SMILES:ClC1=NC=2C(=NC=NC2C=C1)N3CCNCC3
Synonyms:
  • Pyrido[3,2-d]pyrimidine, 6-chloro-4-(1-piperazinyl)-
  • 6-Chloro-4-(1-piperazinyl)pyrido[3,2-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.