CymitQuimica logo

CAS 897373-63-6

:

3-(1,1-Dimethylethyl)-1-(3-quinolinyl)-1H-pyrazol-5-amine

Description:
3-(1,1-Dimethylethyl)-1-(3-quinolinyl)-1H-pyrazol-5-amine, identified by its CAS number 897373-63-6, is a chemical compound characterized by its unique structural features, including a pyrazole ring and a quinoline moiety. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its hydrophobic properties, potentially influencing its solubility and biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. The pyrazole and quinoline components are known for their roles in various biological activities, including anti-inflammatory and anticancer effects. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in further research. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled. Overall, this compound represents a class of heterocyclic compounds that are valuable in the field of pharmaceutical research.
Formula:C16H18N4
InChI:InChI=1S/C16H18N4/c1-16(2,3)14-9-15(17)20(19-14)12-8-11-6-4-5-7-13(11)18-10-12/h4-10H,17H2,1-3H3
InChI key:InChIKey=DXSMYSIGFCYLHP-UHFFFAOYSA-N
SMILES:NC=1N(C2=CC3=C(N=C2)C=CC=C3)N=C(C(C)(C)C)C1
Synonyms:
  • 1H-Pyrazol-5-amine, 3-(1,1-dimethylethyl)-1-(3-quinolinyl)-
  • 3-tert-Butyl-1-(quinolin-3-yl)-1H-pyrazol-5-amine
  • 3-(1,1-Dimethylethyl)-1-(3-quinolinyl)-1H-pyrazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.