CAS 897383-62-9

N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]prop-2-enamide

Description:

N-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]quinazolin-6-yl]prop-2-enamide, with the CAS number 897383-62-9, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinazoline core, an aniline moiety, and a prop-2-enamide functional group. This compound typically exhibits properties associated with its aromatic and heterocyclic components, such as potential biological activity, including anti-cancer or anti-inflammatory effects, which are common in quinazoline derivatives. The presence of chlorine and fluorine substituents can influence its lipophilicity and reactivity, potentially enhancing its pharmacological profile. Additionally, the methoxy group may contribute to its solubility and stability in various solvents. As a result of these characteristics, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for novel therapeutic agents. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₂₄H₁₈ClFN₄O₂

InChI: InChI=1S/C24H18ClFN4O2/c1-2-23(31)29-17-6-8-21-19(11-17)24(28-14-27-21)30-18-7-9-22(20(25)12-18)32-13-15-4-3-5-16(26)10-15/h2-12,14H,1,13H2,(H,29,31)(H,27,28,30)

SMILES: C=CC(=Nc1ccc2c(c1)c(ncn2)Nc1ccc(c(c1)Cl)OCc1cccc(c1)F)O

Synonyms:

• Ast-1306
• Allitinib(AST-1306)

Allitinib

CAS: 897383-62-9

Allitinib (AST-1306) (AST-1306) has anti-cancer activity，and it is an irreversible EGFR and ErbB2 inhibitor with IC50s of 0.5 and 3 nM, respectively. [1]

Formula: C₂₄H₁₈ClFN₄O₂

Purity: 99.89% - 99.91%

Color and Shape: Solid

Molecular weight: 448.88

Ref: TM-T14336

AST-1306

CAS: 897383-62-9

Formula: C₂₄H₁₈ClFN₄O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 448.8767

Ref: IN-DA00GU10

Allitinib

CAS: 897383-62-9

Allitinib

Purity: ≥98%

Molecular weight: 448.88g/mol

Ref: 54-BUP08979

AST-1306

CAS: 897383-62-9

AST-1306 is an irreversible inhibitor, which is a compound designed to target specific enzymes. It stems from advanced pharmaceutical research in the field of cancer therapeutics with a mechanism of targeting the epidermal growth factor receptor (EGFR) kinase. Through covalent bonding, AST-1306 effectively impairs the function of EGFR by forming a stable, permanent bond with its active site, leading to sustained suppression of downstream signaling pathways involved in cellular proliferation and survival.

Formula: C₂₄H₁₈ClFN₄O₂

Purity: Min. 95%

Molecular weight: 448.88 g/mol

Ref: 3D-XKB38362