
CAS 89743-87-3
:2-Chloro-7,9-dihydro-7-methyl-9-phenyl-8H-purin-8-one
Description:
2-Chloro-7,9-dihydro-7-methyl-9-phenyl-8H-purin-8-one, with the CAS number 89743-87-3, is a purine derivative characterized by its complex bicyclic structure, which includes a fused imidazole and pyrimidine ring system. This compound features a chlorine atom at the 2-position and a phenyl group at the 9-position, contributing to its unique chemical properties. The presence of a methyl group at the 7-position enhances its hydrophobic characteristics, while the overall structure suggests potential biological activity, particularly in relation to nucleobase analogs. The compound may exhibit interactions with various biological targets, making it of interest in medicinal chemistry and pharmacology. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research and development. Overall, 2-Chloro-7,9-dihydro-7-methyl-9-phenyl-8H-purin-8-one represents a significant compound for further exploration in both synthetic and biological contexts.
Formula:C12H9ClN4O
InChI:InChI=1S/C12H9ClN4O/c1-16-9-7-14-11(13)15-10(9)17(12(16)18)8-5-3-2-4-6-8/h2-7H,1H3
InChI key:InChIKey=AMYHGLGAXCMWEP-UHFFFAOYSA-N
SMILES:O=C1N(C=2C(N1C)=CN=C(Cl)N2)C3=CC=CC=C3
Synonyms:- 2-Chloro-7,9-dihydro-7-methyl-9-phenyl-8H-purin-8-one
- 2-Chloro-7-methyl-9-phenyl-8,9-dihydro-purin-8-one
- 2-Chloro-7-methyl-9-phenylpurin-8-one
- 8H-Purin-8-one, 2-chloro-7,9-dihydro-7-methyl-9-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8H-Purin-8-one, 2-chloro-7,9-dihydro-7-methyl-9-phenyl-
CAS:Formula:C12H9ClN4OMolecular weight:260.6791
