
CAS 897554-57-3
:2-(5-Chloro-2-thienyl)-5,8-dimethyl-4-quinolinecarboxylic acid
Description:
2-(5-Chloro-2-thienyl)-5,8-dimethyl-4-quinolinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a thienyl group and multiple methyl groups. The presence of the chloro substituent on the thienyl ring contributes to its unique reactivity and potential biological activity. This compound is likely to exhibit properties typical of quinoline derivatives, such as antimicrobial or anti-inflammatory activities, making it of interest in pharmaceutical research. The carboxylic acid functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. Additionally, the presence of multiple methyl groups can affect the compound's lipophilicity and overall pharmacokinetic profile. As with many synthetic organic compounds, its stability, reactivity, and potential applications would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reagents. Overall, this compound represents a class of heterocyclic compounds with diverse applications in medicinal chemistry.
Formula:C16H12ClNO2S
InChI:InChI=1S/C16H12ClNO2S/c1-8-3-4-9(2)15-14(8)10(16(19)20)7-11(18-15)12-5-6-13(17)21-12/h3-7H,1-2H3,(H,19,20)
InChI key:InChIKey=DPUFZNWNTNDUJM-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C=3SC(Cl)=CC3)C(C)=CC=C2C
Synonyms:- 4-Quinolinecarboxylic acid, 2-(5-chloro-2-thienyl)-5,8-dimethyl-
- 2-(5-Chloro-2-thienyl)-5,8-dimethyl-4-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.