CAS 897559-96-5

6-Chloro-2-(4-ethylphenyl)-4-quinolinecarboxylic acid

Description:

6-Chloro-2-(4-ethylphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. The presence of a chloro group at the 6-position and an ethylphenyl substituent at the 2-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic characteristics. It is often studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The carboxylic acid functional group enhances its reactivity, allowing for various chemical modifications. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which can be explored in drug development. As with many chemical substances, safety and handling precautions should be observed, particularly due to the presence of the chloro substituent, which may pose toxicity concerns.

Formula: C₁₈H₁₄ClNO₂

InChI: InChI=1S/C18H14ClNO2/c1-2-11-3-5-12(6-4-11)17-10-15(18(21)22)14-9-13(19)7-8-16(14)20-17/h3-10H,2H2,1H3,(H,21,22)

InChI key: InChIKey=XIDXIZSQZHZIAH-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(CC)C=C3)C=CC(Cl)=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 6-chloro-2-(4-ethylphenyl)-
• 6-Chloro-2-(4-ethylphenyl)-4-quinolinecarboxylic acid