CAS 897560-14-4

6-Chloro-2-(2-ethoxyphenyl)-4-quinolinecarboxylic acid

Description:

6-Chloro-2-(2-ethoxyphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 6-position and an ethoxyphenyl group at the 2-position, contributing to its unique chemical properties. The carboxylic acid functional group at the 4-position enhances its acidity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of the ethoxy group may also affect its lipophilicity and biological activity. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as quinoline derivatives are known for various pharmacological activities, including antimicrobial and anti-inflammatory properties. Its molecular structure allows for interactions with biological targets, making it a candidate for further research in therapeutic applications. As with many chemical substances, safety and handling precautions should be observed due to its potential biological effects.

Formula: C₁₈H₁₄ClNO₃

InChI: InChI=1S/C18H14ClNO3/c1-2-23-17-6-4-3-5-12(17)16-10-14(18(21)22)13-9-11(19)7-8-15(13)20-16/h3-10H,2H2,1H3,(H,21,22)

InChI key: InChIKey=WXUKMVSZQUJNKK-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C2=NC3=C(C(C(O)=O)=C2)C=C(Cl)C=C3)C=CC=C1

Synonyms:

• 4-Quinolinecarboxylic acid, 6-chloro-2-(2-ethoxyphenyl)-
• 6-Chloro-2-(2-ethoxyphenyl)-4-quinolinecarboxylic acid