CAS 897560-16-6
:6-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarboxylic acid
Description:
6-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro substituent at the 6-position and an ethoxyphenyl group at the 2-position, contributing to its unique chemical properties. The carboxylic acid functional group at the 4-position enhances its acidity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of the ethoxy group may also affect its lipophilicity and biological activity. This compound is of interest in medicinal chemistry and may exhibit various pharmacological properties, making it a candidate for further research in drug development. Its CAS number, 897560-16-6, allows for easy identification and reference in chemical databases. Overall, the combination of its functional groups and structural features suggests potential applications in therapeutic contexts, although specific biological activities would require empirical investigation.
Formula:C18H14ClNO3
InChI:InChI=1S/C18H14ClNO3/c1-2-23-13-5-3-4-11(8-13)17-10-15(18(21)22)14-9-12(19)6-7-16(14)20-17/h3-10H,2H2,1H3,(H,21,22)
InChI key:InChIKey=RVRKQSRUWLJSAG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C3=CC(OCC)=CC=C3)C=CC(Cl)=C2
Synonyms:- 6-Chloro-2-(3-ethoxyphenyl)-4-quinolinecarboxylic acid
- 4-Quinolinecarboxylic acid, 6-chloro-2-(3-ethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.