CAS 897560-18-8

6-Chloro-2-(4-ethoxyphenyl)-4-quinolinecarboxylic acid

Description:

6-Chloro-2-(4-ethoxyphenyl)-4-quinolinecarboxylic acid is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a chloro group at the 6-position and an ethoxyphenyl group at the 2-position, contributing to its unique chemical properties and potential biological activity. The carboxylic acid functional group at the 4-position enhances its solubility in polar solvents and may influence its reactivity and interaction with biological targets. The presence of the chloro substituent can also affect the compound's electronic properties, potentially enhancing its pharmacological profile. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as quinoline derivatives are known for various biological activities, including antimicrobial and anticancer properties. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in different environments.

Formula: C₁₈H₁₄ClNO₃

InChI: InChI=1S/C18H14ClNO3/c1-2-23-13-6-3-11(4-7-13)17-10-15(18(21)22)14-9-12(19)5-8-16(14)20-17/h3-10H,2H2,1H3,(H,21,22)

InChI key: InChIKey=OZUXCIVKCYOOSP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3=CC=C(OCC)C=C3)C=CC(Cl)=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 6-chloro-2-(4-ethoxyphenyl)-
• 6-Chloro-2-(4-ethoxyphenyl)-4-quinolinecarboxylic acid