CAS 897561-18-1
:6-(1-Methylethyl)-2-(3-pyridinyl)-4-quinolinecarboxylic acid
Description:
6-(1-Methylethyl)-2-(3-pyridinyl)-4-quinolinecarboxylic acid, with the CAS number 897561-18-1, is a chemical compound characterized by its complex structure, which includes a quinoline core substituted with a pyridine ring and an isopropyl group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as potential biological activity due to its ability to interact with various biological targets. It may possess acidic properties due to the carboxylic acid functional group, influencing its solubility and reactivity in different environments. The presence of both the pyridine and quinoline moieties suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's structural features may contribute to its stability and reactivity, making it of interest in various chemical synthesis and research applications. As with many such compounds, its specific characteristics, including solubility, melting point, and reactivity, would depend on the conditions under which it is studied.
Formula:C18H16N2O2
InChI:InChI=1S/C18H16N2O2/c1-11(2)12-5-6-16-14(8-12)15(18(21)22)9-17(20-16)13-4-3-7-19-10-13/h3-11H,1-2H3,(H,21,22)
InChI key:InChIKey=VUQPPTJUDWPEKS-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C2=C(N=C(C1)C=3C=CC=NC3)C=CC(C(C)C)=C2
Synonyms:- 4-Quinolinecarboxylic acid, 6-(1-methylethyl)-2-(3-pyridinyl)-
- 6-(1-Methylethyl)-2-(3-pyridinyl)-4-quinolinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.