CAS 897565-71-8

4-Quinolinecarboxylic acid, 2-cyclopropyl-6-methoxy-

Description:

4-Quinolinecarboxylic acid, 2-cyclopropyl-6-methoxy- is an organic compound characterized by its quinoline structure, which consists of a fused bicyclic system containing a benzene ring and a pyridine ring. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of a cyclopropyl group and a methoxy group on the quinoline ring influences its chemical properties, including its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various interactions, such as hydrogen bonding and π-π stacking, which can affect its behavior in biological systems. Additionally, the compound's unique substituents may enhance its pharmacological profile, potentially leading to applications in treating various diseases. Overall, 4-Quinolinecarboxylic acid, 2-cyclopropyl-6-methoxy- represents a class of compounds that are valuable for their diverse chemical properties and potential therapeutic uses.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-18-9-4-5-12-10(6-9)11(14(16)17)7-13(15-12)8-2-3-8/h4-8H,2-3H2,1H3,(H,16,17)

InChI key: InChIKey=NMVCLMGYUWYUDB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C2=C(N=C(C1)C3CC3)C=CC(OC)=C2

Synonyms:

• 4-Quinolinecarboxylic acid, 2-cyclopropyl-6-methoxy-
• 2-Cyclopropyl-6-methoxyquinoline-4-carboxylic acid

2-Cyclopropyl-6-methoxyquinoline-4-carboxylic acid

CAS: 897565-71-8

Versatile small molecule scaffold

Formula: C₁₄H₁₃NO₃

Purity: Min. 95%

Molecular weight: 243.26 g/mol

Ref: 3D-XKB56571