
CAS 89762-39-0
:(2S)-2,3,5,6-Tetrahydro-5,6-dioxo-1H-indole-2-carboxylic acid
Description:
(2S)-2,3,5,6-Tetrahydro-5,6-dioxo-1H-indole-2-carboxylic acid, with CAS number 89762-39-0, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a six-membered benzene ring fused to a five-membered nitrogen-containing pyrrole ring. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of dioxo groups indicates that it has two carbonyl functionalities, which can participate in various chemical transformations, including nucleophilic additions and condensation reactions. The stereochemistry denoted by (2S) suggests a specific spatial arrangement of atoms, which can influence the compound's biological activity and interactions. This compound may be of interest in medicinal chemistry and pharmacology due to its structural features, which could be relevant for the development of therapeutic agents. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or applications.
Formula:C9H7NO4
InChI:InChI=1S/C9H7NO4/c11-7-2-4-1-6(9(13)14)10-5(4)3-8(7)12/h2-3,6,10H,1H2,(H,13,14)/t6-/m0/s1
InChI key:InChIKey=VJNCICVKUHKIIV-LURJTMIESA-N
SMILES:C(O)(=O)[C@@H]1CC=2C(N1)=CC(=O)C(=O)C2
Synonyms:- (2S)-5,6-Dioxo-2,3,5,6-tetrahydro-1H-indole-2-carboxylic acid
- L-Dopachrome
- 1H-Indole-2-carboxylic acid, 2,3,5,6-tetrahydro-5,6-dioxo-, (S)-
- (2S)-2,3,5,6-Tetrahydro-5,6-dioxo-1H-indole-2-carboxylic acid
- 1H-Indole-2-carboxylic acid, 2,3,5,6-tetrahydro-5,6-dioxo-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1H-Indole-2-carboxylicacid, 2,3,5,6-tetrahydro-5,6-dioxo-, (2S)-
CAS:Formula:C9H7NO4Molecular weight:193.1562
