CAS 897653-01-9
:7-Oxa-3-azabicyclo[4.1.0]heptane-3-carboxylic acid
Description:
7-Oxa-3-azabicyclo[4.1.0]heptane-3-carboxylic acid is a bicyclic compound characterized by its unique structural framework, which includes a nitrogen atom and an oxygen atom incorporated into the bicyclic system. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The bicyclic structure provides rigidity and can influence the compound's biological activity and interaction with other molecules. The presence of both nitrogen and oxygen atoms in the ring system may enhance its solubility in polar solvents and its ability to form hydrogen bonds. Such characteristics make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's specific stereochemistry and functional groups can significantly affect its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Overall, 7-Oxa-3-azabicyclo[4.1.0]heptane-3-carboxylic acid represents a class of compounds that may exhibit diverse biological activities, warranting further investigation for potential therapeutic applications.
Formula:C6H9NO3
InChI:InChI=1S/C6H9NO3/c8-6(9)7-2-1-4-5(3-7)10-4/h4-5H,1-3H2,(H,8,9)
InChI key:InChIKey=NQLSDPXGVIPAJR-UHFFFAOYSA-N
SMILES:C(O)(=O)N1CC2C(O2)CC1
Synonyms:- 7-Oxa-3-azabicyclo[4.1.0]heptane-3-carboxylic acid
- 7-Oxa-3-azabicyclo[4.1.0]heptane-3-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
