CAS 897660-84-3

4-Oxo-1-propylcyclohexanecarboxylic acid

Description:

4-Oxo-1-propylcyclohexanecarboxylic acid, identified by its CAS number 897660-84-3, is an organic compound characterized by a cyclohexane ring with a carboxylic acid functional group and a ketone group. This compound features a propyl substituent at the 1-position and a keto group at the 4-position of the cyclohexane ring. The presence of both the carboxylic acid and ketone functional groups suggests that it may exhibit acidic properties and participate in various chemical reactions, such as esterification or condensation. The structure contributes to its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the compound's physical properties, such as solubility and melting point, would be influenced by its molecular structure and functional groups. Overall, 4-Oxo-1-propylcyclohexanecarboxylic acid represents a versatile building block in organic chemistry, with potential utility in various chemical processes.

Formula: C₁₀H₁₆O₃

InChI: InChI=1S/C10H16O3/c1-2-5-10(9(12)13)6-3-8(11)4-7-10/h2-7H2,1H3,(H,12,13)

InChI key: InChIKey=RFFOMLCWHVAHPF-UHFFFAOYSA-N

SMILES: C(CC)C1(C(O)=O)CCC(=O)CC1

Synonyms:

• Cyclohexanecarboxylic acid, 4-oxo-1-propyl-
• 4-Oxo-1-propyl-cyclohexanecarboxylic acid
• 4-Oxo-1-propylcyclohexanecarboxylic acid