CymitQuimica logo

CAS 89767-26-0

:

1,3,2-Diazaphospholidine, 2-phenoxy-1-propyl-

Description:
1,3,2-Diazaphospholidine, 2-phenoxy-1-propyl- is a chemical compound characterized by its unique structure, which includes a five-membered ring containing both nitrogen and phosphorus atoms. This compound features a diazaphospholidine framework, indicating the presence of two nitrogen atoms and one phosphorus atom within the ring. The addition of a phenoxy group and a propyl chain contributes to its overall reactivity and potential applications in various chemical processes. Typically, compounds of this nature may exhibit properties such as moderate stability, potential for coordination with metal ions, and interesting reactivity patterns due to the presence of the phosphorus atom, which can participate in various chemical reactions. The presence of the phenoxy group may also enhance solubility in organic solvents and influence the compound's biological activity. Overall, 1,3,2-Diazaphospholidine, 2-phenoxy-1-propyl- represents a class of organophosphorus compounds that can be explored for applications in fields such as catalysis, materials science, and pharmaceuticals.
Formula:C11H17N2OP
InChI:InChI=1S/C11H17N2OP/c1-2-9-13-10-8-12-15(13)14-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3
InChI key:InChIKey=BAZCFMXCOSCWTG-UHFFFAOYSA-N
SMILES:O(P1N(CCC)CCN1)C2=CC=CC=C2
Synonyms:
  • 2-Phenoxy-1-propyl-1,3,2-diazaphospholidine
  • 1,3,2-Diazaphospholidine, 2-phenoxy-1-propyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.