CAS 89770-26-3
:8-Nitro-4-quinolinamine
Description:
8-Nitro-4-quinolinamine is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the heterocyclic ring. This substance features a nitro group (-NO2) at the 8-position and an amino group (-NH2) at the 4-position of the quinoline ring, contributing to its unique reactivity and properties. It is typically a yellow to orange solid, and its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The presence of both the nitro and amino groups can influence its solubility, stability, and interaction with biological targets. Additionally, 8-Nitro-4-quinolinamine may exhibit properties such as fluorescence, making it useful in various analytical applications. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Proper safety measures should be observed when working with this compound in laboratory settings.
Formula:C9H7N3O2
InChI:InChI=1S/C9H7N3O2/c10-7-4-5-11-9-6(7)2-1-3-8(9)12(13)14/h1-5H,(H2,10,11)
InChI key:InChIKey=KHXNBKYPUALXTE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C2=C(C(N)=CC=N2)C=CC1
Synonyms:- 4-Quinolinamine, 8-nitro-
- Quinoline, 4-amino-8-nitro-
- 8-Nitro-4-quinolinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
