
CAS 89775-34-8
:4-Methyl-2-thiazolepropanol
Description:
4-Methyl-2-thiazolepropanol, identified by its CAS number 89775-34-8, is an organic compound characterized by the presence of a thiazole ring and a propanol group. This compound typically exhibits a molecular structure that includes a methyl group attached to the thiazole, which contributes to its unique chemical properties. It is generally a colorless to pale yellow liquid with a distinctive odor, often associated with its use in various applications, including as a flavoring agent or in the synthesis of other chemical compounds. The thiazole moiety imparts certain reactivity, making it useful in organic synthesis and potentially in pharmaceutical applications. Its solubility in polar solvents and moderate volatility are also notable characteristics. Safety data sheets should be consulted for handling and storage guidelines, as with many organic compounds, it may pose certain health and environmental risks. Overall, 4-Methyl-2-thiazolepropanol is a compound of interest in both industrial and research settings due to its functional properties.
Formula:C7H11NOS
InChI:InChI=1S/C7H11NOS/c1-6-5-10-7(8-6)3-2-4-9/h5,9H,2-4H2,1H3
InChI key:InChIKey=BAAGDLAPXSHNJF-UHFFFAOYSA-N
SMILES:C(CCO)C1=NC(C)=CS1
Synonyms:- 2-Thiazolepropanol, 4-methyl-
- 4-Methyl-2-thiazolepropanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.