CymitQuimica logo

CAS 89776-82-9

:

ethyl (5R)-2-methyl-4-oxo-4,5-dihydro-1,3-thiazole-5-carboxylate

Description:
Ethyl (5R)-2-methyl-4-oxo-4,5-dihydro-1,3-thiazole-5-carboxylate, with the CAS number 89776-82-9, is a chemical compound characterized by its thiazole ring structure, which incorporates both a carbonyl and a carboxylate functional group. This compound typically exhibits properties associated with thiazoles, such as potential biological activity and reactivity due to the presence of the thiazole moiety. The ethyl ester group contributes to its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. The specific stereochemistry indicated by the (5R) designation suggests that the compound has a defined spatial arrangement, which can influence its biological interactions and pharmacological properties. Additionally, the presence of the methyl group at the 2-position may affect the compound's reactivity and stability. Overall, this compound is of interest in research contexts, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features and potential functional properties.
Formula:C7H9NO3S
InChI:InChI=1/C7H9NO3S/c1-3-11-7(10)5-6(9)8-4(2)12-5/h5H,3H2,1-2H3/t5-/m1/s1
SMILES:CCOC(=O)[C@H]1C(=O)N=C(C)S1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.