CAS 89781-53-3
:7-Bromo-5,6,7,8-tetrahydro-8-oxo-2-naphthalenecarboxylic acid
Description:
7-Bromo-5,6,7,8-tetrahydro-8-oxo-2-naphthalenecarboxylic acid is a chemical compound characterized by its complex bicyclic structure, which includes a naphthalene moiety. The presence of a bromine atom at the 7-position and a carboxylic acid functional group contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The tetrahydro configuration indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring system that can influence its physical properties, such as solubility and boiling point. The keto group at the 8-position enhances the compound's electrophilic character, making it a potential candidate for further chemical transformations. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in pharmaceutical research. Its CAS number, 89781-53-3, allows for easy identification in chemical databases and literature. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior, which is crucial for its potential applications.
Formula:C11H9BrO3
InChI:InChI=1S/C11H9BrO3/c12-9-4-3-6-1-2-7(11(14)15)5-8(6)10(9)13/h1-2,5,9H,3-4H2,(H,14,15)
InChI key:InChIKey=YGDCUSQZLIHNCA-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC=C(C(O)=O)C2)CCC1Br
Synonyms:- 2-Bromo-3,4-dihydro-7-carboxy-1-(2H)-naphthalenone
- 2-Naphthalenecarboxylic acid, 7-bromo-5,6,7,8-tetrahydro-8-oxo-
- 7-Bromo-5,6,7,8-tetrahydro-8-oxo-2-naphthalenecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Naphthalenecarboxylic acid, 7-bromo-5,6,7,8-tetrahydro-8-oxo-
CAS:Formula:C11H9BrO3Molecular weight:269.0914
