CAS 89782-92-3

N-[(2-Chlorophenyl)methyl]sulfamic acid

Description:

N-[(2-Chlorophenyl)methyl]sulfamic acid, with the CAS number 89782-92-3, is an organic compound characterized by the presence of a sulfamic acid functional group attached to a 2-chlorobenzyl moiety. This compound typically appears as a solid and is soluble in polar solvents, reflecting its polar nature due to the sulfamic acid group. The presence of the chlorophenyl group may impart specific electronic properties, influencing its reactivity and potential applications in various chemical reactions. Sulfamic acids are known for their acidity and can act as sulfonating agents, making this compound potentially useful in organic synthesis and as an intermediate in the production of other chemical substances. Additionally, the chlorinated aromatic ring may enhance the compound's biological activity, suggesting potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper safety measures are in place.

Formula: C₇H₈ClNO₃S

InChI: InChI=1S/C7H8ClNO3S/c8-7-4-2-1-3-6(7)5-9-13(10,11)12/h1-4,9H,5H2,(H,10,11,12)

InChI key: InChIKey=NVZUFMJHOXUAPP-UHFFFAOYSA-N

SMILES: C(NS(=O)(=O)O)C1=C(Cl)C=CC=C1

Synonyms:

• N-[(2-Chlorophenyl)methyl]sulfamic acid
• N-(2-Chlorobenzyl)sulfamic acid
• Sulfamic acid, N-[(2-chlorophenyl)methyl]-
• Sulfamic acid, [(2-chlorophenyl)methyl]-
• (2-Chlorobenzyl)sulfamic acid

Sulfamic acid, [(2-chlorophenyl)methyl]-

CAS: 89782-92-3

Formula: C₇H₈ClNO₃S

Molecular weight: 221.6613

Ref: IN-DA003ZWO