CAS 89783-74-4
:9,10-Dihydroxy-5-methoxy-2H-pyrano[2,3,4-kl]xanthen-2-one
Description:
9,10-Dihydroxy-5-methoxy-2H-pyrano[2,3,4-kl]xanthen-2-one, with the CAS number 89783-74-4, is a synthetic organic compound belonging to the class of xanthenes. This compound features a complex polycyclic structure characterized by a pyran ring fused to a xanthene core, which contributes to its unique chemical properties. The presence of hydroxyl (-OH) and methoxy (-OCH3) functional groups enhances its solubility and reactivity, making it of interest in various applications, including as a dye or in photochemical processes. The compound exhibits notable fluorescence properties, which can be exploited in biological imaging and sensing applications. Additionally, its structural features may confer potential biological activities, although specific pharmacological data may vary. The stability of this compound under different conditions, such as pH and temperature, is essential for its practical applications. Overall, 9,10-Dihydroxy-5-methoxy-2H-pyrano[2,3,4-kl]xanthen-2-one represents a fascinating subject for research in organic chemistry and materials science.
Formula:C16H10O6
InChI:InChI=1S/C16H10O6/c1-20-7-2-13-16-9(5-15(19)22-14(16)3-7)8-4-10(17)11(18)6-12(8)21-13/h2-6,17-18H,1H3
InChI key:InChIKey=KOCNWAKMXCTCIO-UHFFFAOYSA-N
SMILES:O=C1C=C2C=3C(OC=4C2=CC(O)=C(O)C4)=CC(OC)=CC3O1
Synonyms:- 2H-Pyrano[2,3,4-kl]xanthen-2-one, 9,10-dihydroxy-5-methoxy-
- 9,10-Dihydroxy-5-methoxy-2H-pyrano[2,3,4-kl]xanthen-2-one
- 9,10-Dihydroxy-5-methoxy-2H-pyrano(2,3,4-kl)xanthen-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2H-Pyrano[2,3,4-kl]xanthen-2-one,9,10-dihydroxy-5-methoxy-
CAS:Formula:C16H10O6Molecular weight:298.2479,10-Dihydroxy-5-methoxy-2H-pyrano[2,3,4-kl]xanthen-2-one
CAS:Controlled ProductFormula:C16H10O6Color and Shape:NeatMolecular weight:298.247

