CAS 89786-57-2

2-Methylthiazolo[4,5-c]pyridine

Description:

2-Methylthiazolo[4,5-c]pyridine is a heterocyclic compound characterized by a fused thiazole and pyridine ring system. This compound features a methyl group at the 2-position of the thiazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit a range of physical properties such as solubility in organic solvents, depending on the specific conditions. The presence of both nitrogen and sulfur atoms in its structure imparts distinct reactivity, making it of interest in various fields, including medicinal chemistry and material science. 2-Methylthiazolo[4,5-c]pyridine may participate in diverse chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-rich nature of the pyridine nitrogen. Its derivatives are often explored for biological activity, including potential antimicrobial and anticancer properties. As with many heterocycles, the compound's stability and reactivity can be influenced by substituents and environmental factors, making it a subject of ongoing research in synthetic and medicinal chemistry.

Formula: C₇H₆N₂S

InChI: InChI=1S/C7H6N2S/c1-5-9-6-4-8-3-2-7(6)10-5/h2-4H,1H3

InChI key: InChIKey=YODDSQSDFALFLC-UHFFFAOYSA-N

SMILES: CC1=NC=2C(S1)=CC=NC2

Synonyms:

• 2-Methyl-[1,3]thiazolo[4,5-c]pyridine
• 2-Methylthiazolo[4,5-c]pyridine
• Thiazolo[4,5-c]pyridine, 2-methyl-

2-Methyl-[1,3]thiazolo[4,5-c]pyridine

CAS: 89786-57-2

Versatile small molecule scaffold

Formula: C₇H₆N₂S

Purity: Min. 95%

Molecular weight: 150.2 g/mol

Ref: 3D-PDA78657