CAS 89786-84-5
:Myrianthic acid
Description:
Myrianthic acid, with the CAS number 89786-84-5, is a naturally occurring organic compound classified as a fatty acid. It is primarily derived from certain plant sources and is known for its unique structural features, which include a long hydrocarbon chain and functional carboxylic acid group. This compound exhibits characteristics typical of fatty acids, such as being hydrophobic due to its long carbon chain, while the carboxylic group imparts some degree of hydrophilicity. Myrianthic acid may play a role in various biological processes, including plant metabolism and signaling. Additionally, it has garnered interest in the field of biochemistry for its potential applications in pharmaceuticals and as a biochemical marker. Its solubility properties, reactivity, and interactions with other molecules can vary based on environmental conditions and the presence of other functional groups. Overall, myrianthic acid represents a fascinating subject of study within organic chemistry and natural product research.
Formula:C30H48O6
InChI:InChI=1S/C30H48O6/c1-17-9-12-30(24(34)35)14-13-27(4)18(22(30)29(17,6)36)7-8-21-25(2)15-19(32)23(33)26(3,16-31)20(25)10-11-28(21,27)5/h7,17,19-23,31-33,36H,8-16H2,1-6H3,(H,34,35)/t17-,19-,20-,21-,22-,23-,25+,26+,27-,28-,29-,30+/m1/s1
InChI key:InChIKey=YCOKATFNRPZIIU-MGBZEVKYSA-N
SMILES:C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)([C@@](CO)(C)[C@H](O)[C@H](O)C5)[H])[H])([C@](C)(O)[C@H](C)CC2)[H]
Synonyms:- (2α,3α,4α)-2,3,19,23-Tetrahydroxyurs-12-en-28-oic acid
- Urs-12-en-28-oic acid, 2,3,19,23-tetrahydroxy-, (2α,3α,4α)-
- Myrianthic acid
- 2α,3α,19α,23-Tetrahydroxyurs-12-en-28-oic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Myrianthic acid
CAS:Myrianthic acid shows anticancer activity, it shows inhibitory activities on foam cell formation in human monocyte-derived macrophages induced by acetylated lowFormula:C30H48O6Purity:98%Color and Shape:SolidMolecular weight:504.73beta-Myrianthic acid
CAS:Controlled Product3beta-Myrianthic acid is a triterpenoid compound, which is naturally derived from the plant Myrianthus arboreus. This species belongs to the Moraceae family, known for a wide array of bioactive substances. The compound exhibits its effects through several biochemical pathways, modulating multiple target sites, including anti-inflammatory and antiproliferative activities. Its mode of action primarily involves the inhibition of key enzymes and signaling pathways, contributing to its potential therapeutic applications. Researchers have shown interest in 3beta-Myrianthic acid for its potential utility in pharmaceutical and biotechnological fields, specifically as a candidate for developing new anti-cancer and anti-inflammatory agents. The compound's efficacy in preclinical studies highlights its promise, making it a subject of ongoing research with the aim to uncover further therapeutic possibilities.Formula:C30H48O6Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:504.7 g/mol


