CAS 89787-12-2
:(2-Isopropylphenyl)boronic acid
Description:
(2-Isopropylphenyl)boronic acid, with the CAS number 89787-12-2, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with an isopropyl group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It exhibits the ability to form reversible covalent bonds with diols, making it useful in various applications, particularly in organic synthesis and medicinal chemistry. The boronic acid functionality allows it to participate in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, (2-Isopropylphenyl)boronic acid can act as a ligand in coordination chemistry and has potential applications in drug development due to its ability to interact with biological molecules. Its stability and reactivity can be influenced by factors such as pH and the presence of other functional groups, making it a versatile compound in synthetic chemistry.
Formula:C9H13BO2
InChI:InChI=1/C9H13BO2/c1-7(2)8-5-3-4-6-9(8)10(11)12/h3-7,11-12H,1-2H3
SMILES:CC(C)c1ccccc1B(O)O
Synonyms:- 2-Isopropylbenzeneboronic acid
- 2-Cumylboronic acid~2-Isopropylphenylboronic acid
- [2-(1-Methylethyl)Phenyl]Boronic Acid
- 2-Isopropylphenylboronic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Isopropylbenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C9H13BO2Purity:97%Color and Shape:White, PowderMolecular weight:164.01(2-Isopropylphenyl)boronic acid
CAS:Formula:C9H13BO2Purity:97%Color and Shape:SolidMolecular weight:164.00932-Isopropylbenzeneboronic acid
CAS:2-Isopropylbenzeneboronic acidFormula:C9H13BO2Purity:≥95%Color and Shape: off-white crystalsMolecular weight:164.01g/mol(2-Isopropylphenyl)boronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C9H13BO2Color and Shape:White to Light yellow powder to crystalMolecular weight:164.012-Isopropylphenylboronic acid
CAS:Formula:C9H13BO2Purity:98%Color and Shape:Solid, White powderMolecular weight:164.01





