CAS 89787-13-3

B-[2-(1,1-Dimethylethyl)phenyl]boronic acid

Description:

B-[2-(1,1-Dimethylethyl)phenyl]boronic acid, with the CAS number 89787-13-3, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a tert-butyl group. This compound typically exhibits properties such as being a white to off-white solid at room temperature and is soluble in organic solvents like dichloromethane and ethanol, while being less soluble in water due to its hydrophobic tert-butyl substituent. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. Additionally, it can form reversible complexes with diols, which is significant for applications in sensor technology and drug delivery systems. Its stability and reactivity can be influenced by the steric hindrance provided by the tert-butyl group, affecting its interactions in chemical processes. Overall, this compound is notable for its utility in synthetic organic chemistry and materials science.

Formula: C₁₀H₁₅BO₂

InChI: InChI=1S/C10H15BO2/c1-10(2,3)8-6-4-5-7-9(8)11(12)13/h4-7,12-13H,1-3H3

InChI key: InChIKey=LXLMKMLQQJSOCB-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=C(B(O)O)C=CC=C1

Synonyms:

• Boronic acid, [2-(1,1-dimethylethyl)phenyl]-
• Boronic acid, B-[2-(1,1-dimethylethyl)phenyl]-
• (2-tert-Butylphenyl)boronic acid
• B-[2-(1,1-Dimethylethyl)phenyl]boronic acid

Boronic acid, [2-(1,1-dimethylethyl)phenyl]-

CAS: 89787-13-3

Formula: C₁₀H₁₅BO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 178.0359

Ref: IN-DA003YHE

(2-(tert-Butyl)phenyl)boronic acid

CAS: 89787-13-3

(2-(tert-Butyl)phenyl)boronic acid

Purity: 97%

Molecular weight: 178.04g/mol

Ref: 54-OR1074981

(2-tert-Butylphenyl)boronic acid

CAS: 89787-13-3

Purity: 97%

Molecular weight: 178.0399933

Ref: 10-F646216

(2-tert-Butylphenyl)boronic acid

CAS: 89787-13-3

2-tert-Butylphenylboronic acid is a versatile and useful reagent that is used in organic synthesis for the preparation of chiral boronates. This compound has been shown to form complexes with many different metal ions and can be used to synthesize supramolecular structures. Studies have shown that 2-tert-butylphenylboronic acid reacts with diastereomeric biphenyls in the presence of a base to form a complex that can be separated into its two diastereomers by crystallization, affording two different products.

Formula: C₁₀H₁₅BO₂

Purity: Min. 95%

Molecular weight: 178.04 g/mol

Ref: 3D-PDA78713