CAS 89789-07-1
:Benzhydry 2β-triazolmethyl-2α-methyl-6,6-dihydropernicillanate-1,1-dioxide
Description:
Benzhydry 2β-triazolmethyl-2α-methyl-6,6-dihydropernicillanate-1,1-dioxide, identified by its CAS number 89789-07-1, is a synthetic compound that belongs to the class of penicillin derivatives. This substance features a complex molecular structure characterized by the presence of a triazole ring, which contributes to its biological activity. The incorporation of a benzhydryl group enhances its lipophilicity, potentially improving its ability to penetrate biological membranes. The 1,1-dioxide functional group suggests the presence of sulfone characteristics, which may influence its reactivity and stability. As a derivative of penicillin, it may exhibit antibacterial properties, although specific biological activities would depend on its interaction with bacterial enzymes and receptors. The compound's synthesis and characterization would typically involve advanced organic chemistry techniques, including spectroscopic methods for structural elucidation. Overall, this compound represents a unique modification of traditional penicillin structures, potentially offering novel therapeutic applications in the field of medicinal chemistry.
Formula:C23H22N4O5S
InChI:InChI=1S/C23H22N4O5S/c1-23(15-26-13-12-24-25-26)21(27-18(28)14-19(27)33(23,30)31)22(29)32-20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-13,19-21H,14-15H2,1H3/t19-,21+,23+/m1/s1
InChI key:InChIKey=PHGXFQIAGFMIHJ-NWSQWKLXSA-N
SMILES:C(OC(C1=CC=CC=C1)C2=CC=CC=C2)(=O)[C@@H]3N4[C@](S(=O)(=O)[C@]3(CN5C=CN=N5)C)(CC4=O)[H]
Synonyms:- 1H-1,2,3-Triazole, 4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid deriv.
- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3-methyl-7-oxo-3-(1H-1,2,3-triazol-1-ylmethyl)-, diphenylmethyl ester, 4,4-dioxide, (2S,3S,5R)-
- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3-methyl-7-oxo-3-(1H-1,2,3-triazol-1-ylmethyl)-, diphenylmethyl ester, 4,4-dioxide, [2S-(2α,3β,5α)]-
- Tazobactam Benzhydryl
- Tazobactam Diphenylmethyl Ester
- Benzhydry 2β-triazolmethyl-2α-methyl-6,6-dihydropernicillanate-1,1-dioxide
- (2S,3S,5R)-3-METHYL-7-OXO-3-(1H-1,2,3-TRIAZOLE-1-YLMETHYL)-4 - -THIA-1-AZABICYCLO(3.2.0)-HEPTANE-2-CARBOXYLIC ACID DIPHENYL
- Benzhydry 2beta-triazolmethyl-2alpha-methyl-6,6-dihydropernicillanate-1,1-dioxide
- Tazobactam Impurity 38
- Benzhydry 2β-triazolmethyl-2α-methyl-6,6-dihydropernicillanate-1,1-dioxide
- Tazobactam Acid Impurity 13
- (2S,3S,5R)-benzhydryl 3-((1H-1,2,3-triazol-1-yl)methyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Tazobactam Diphenylmethyl Ester (Benzhydryl (2S,3S,5R)-3-((1H-1,2,3-triazol-1-yl)methyl)-3-methyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide)
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C23H22N4O5SColor and Shape:White PowderMolecular weight:466.13109Tazobactam diphenylmethyl ester
CAS:Formula:C23H22N4O5SPurity:98%Color and Shape:SolidMolecular weight:466.5096Tazobactam Acid Impurity 13
CAS:Formula:C23H22N4O5SColor and Shape:White To Off-White SolidMolecular weight:466.51Tazobactam Diphenylmethyl Ester
CAS:Controlled ProductFormula:C23H22N4O5SColor and Shape:NeatMolecular weight:466.51Tazobactam Diphenylmethyl Ester-15N3
CAS:Controlled ProductFormula:C23H2215N3NO5SColor and Shape:NeatMolecular weight:469.49Tazobactam diphenylmethyl ester
CAS:Tazobactam diphenylmethyl ester is a chemical compound that serves as a precursor or intermediate in the synthesis of beta-lactamase inhibitors. This product originates from synthetic organic chemistry and plays a crucial role in antibiotic research and development. Its mode of action involves modifying or blocking the active site of beta-lactamase enzymes, which are responsible for granting bacteria resistance to beta-lactam antibiotics.
Formula:C23H22N4O5SPurity:Min. 95%Molecular weight:466.5 g/mol








