CAS 89792-10-9

7-Amino-1,2-dihydro-3H-indazol-3-one

Description:

7-Amino-1,2-dihydro-3H-indazol-3-one is a chemical compound characterized by its indazole core, which features a fused five-membered ring structure containing nitrogen atoms. This compound possesses an amino group at the 7-position and a carbonyl group at the 3-position, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid, soluble in polar solvents, and may exhibit moderate stability under standard conditions. The presence of the amino group allows for hydrogen bonding, which can influence its solubility and interaction with biological targets. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of anti-inflammatory and anticancer research. Its unique structural features may also allow for modifications that enhance its pharmacological properties. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, making it a versatile building block in organic synthesis.

Formula: C₇H₇N₃O

InChI: InChI=1S/C7H7N3O/c8-5-3-1-2-4-6(5)9-10-7(4)11/h1-3H,8H2,(H2,9,10,11)

InChI key: InChIKey=CRZHJYBTIUPDSG-UHFFFAOYSA-N

SMILES: NC1=C2C(C(=O)NN2)=CC=C1

Synonyms:

• 3-Indazolinone, 7-amino-
• 7-Amino-1,2-dihydro-3H-indazol-3-one
• 3H-Indazol-3-one, 7-amino-1,2-dihydro-