CAS 89792-76-7
:(2,4-Dichloro-6-methoxyphenyl)hydrazine
Description:
(2,4-Dichloro-6-methoxyphenyl)hydrazine, with the CAS number 89792-76-7, is an organic compound characterized by its hydrazine functional group attached to a substituted phenyl ring. The presence of two chlorine atoms at the 2 and 4 positions and a methoxy group at the 6 position of the phenyl ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential reactivity, particularly in nucleophilic substitution reactions due to the electron-withdrawing effects of the chlorine atoms. Additionally, the methoxy group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other chemical species. (2,4-Dichloro-6-methoxyphenyl)hydrazine may have applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research into its biological activity and safety profile. As with all chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C7H8Cl2N2O
InChI:InChI=1S/C7H8Cl2N2O/c1-12-6-3-4(8)2-5(9)7(6)11-10/h2-3,11H,10H2,1H3
InChI key:InChIKey=RSXGDQAKGGEHBX-UHFFFAOYSA-N
SMILES:O(C)C1=C(NN)C(Cl)=CC(Cl)=C1
Synonyms:- Hydrazine, (2,4-dichloro-6-methoxyphenyl)-
- (2,4-Dichloro-6-methoxyphenyl)hydrazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
