CAS 89794-53-6
:3-methoxycyclohexanol
Description:
3-Methoxycyclohexanol is an organic compound characterized by a cyclohexane ring substituted with a methoxy group (-OCH3) and a hydroxyl group (-OH) at the 3-position. This compound is a colorless to pale yellow liquid with a pleasant odor, and it is soluble in organic solvents while exhibiting limited solubility in water due to its hydrophobic cyclohexane structure. The presence of both the methoxy and hydroxyl groups contributes to its potential as a solvent and intermediate in organic synthesis. 3-Methoxycyclohexanol can participate in various chemical reactions, including nucleophilic substitutions and dehydration, making it useful in the production of other chemical compounds. Its physical properties, such as boiling point and density, can vary based on purity and environmental conditions. Safety data indicates that, like many organic solvents, it should be handled with care, as it may cause irritation upon contact with skin or eyes and should be used in well-ventilated areas to avoid inhalation of vapors.
Formula:C7H14O2
InChI:InChI=1/C7H14O2/c1-9-7-4-2-3-6(8)5-7/h6-8H,2-5H2,1H3
SMILES:COC1CCCC(C1)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Cyclohexanol, 3-methoxy-
CAS:Formula:C7H14O2Purity:97%Color and Shape:LiquidMolecular weight:130.18493-methoxycyclohexan-1-ol
CAS:3-methoxycyclohexan-1-ol is a dipole with the monosubstituted, monomeric structure. It is an isomer of cyclohexanol and can be found as a mixture of two conformers, cis and trans. The molecule has hydrogen bonds between the OH group on C3 and the O atom on C4. 3-methoxycyclohexan-1-ol has been shown to be stabilized by hydrogen bonding to chlorine. The molecule also has intramolecular hydrogen bonding in the form of a bond cleavage. 3-methoxycyclohexan-1-ol has a molecular weight of 114.14 g/mol and its nmr spectrum displays signals in both d and t time domains due to its conformational properties.
Formula:C7H14O2Purity:Min. 95%Molecular weight:130.19 g/mol


