CAS 89795-49-3
:2-(2-Furanyl)-1H-imidazole
Description:
2-(2-Furanyl)-1H-imidazole, with the CAS number 89795-49-3, is an organic compound characterized by its unique structure that combines a furan ring and an imidazole moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The presence of both the furan and imidazole rings can influence its reactivity and interactions with biological targets, potentially leading to various pharmacological effects. Additionally, 2-(2-Furanyl)-1H-imidazole may participate in hydrogen bonding due to the nitrogen atoms in the imidazole ring, which can affect its solubility and stability. The compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry due to its structural features and potential applications.
Formula:C7H6N2O
InChI:InChI=1/C7H6N2O/c1-2-6(10-5-1)7-8-3-4-9-7/h1-5H,(H,8,9)
SMILES:c1cc(c2[nH]ccn2)oc1
Synonyms:- 1H-imidazole, 2-(2-furanyl)-
- 2-(2-Furyl)-1H-imidazole
- 2-(furan-2-yl)-1H-imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
