
CAS 89795-80-2
:1,2,3-Benzotriazin-4-amine
Description:
1,2,3-Benzotriazin-4-amine, with the CAS number 89795-80-2, is a heterocyclic organic compound characterized by its benzotriazine structure, which consists of a fused benzene and triazine ring system. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science. It may possess functional groups that contribute to its reactivity and solubility in different solvents. The presence of the amine group suggests it can participate in hydrogen bonding and may act as a nucleophile in chemical reactions. Additionally, benzotriazine derivatives are known for their potential biological activities, which could include antimicrobial or anticancer properties. The compound's stability, melting point, and solubility characteristics would depend on its specific molecular interactions and substituents. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C7H6N4
InChI:InChI=1S/C7H6N4/c8-7-5-3-1-2-4-6(5)9-11-10-7/h1-4H,(H2,8,9,10)
InChI key:InChIKey=KFTFNTPGDZCQSP-UHFFFAOYSA-N
SMILES:NC=1C2=C(N=NN1)C=CC=C2
Synonyms:- 1,2,3-Benzotriazine, 4-amino-
- 4-Amino-1,2,3-benzotriazine
- 1,2,3-Benzotriazin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.