CAS 897950-84-4

6-(Ethylamino)-4-(3-methoxypropyl)-2H-1,4-benzoxazin-3(4H)-one

Description:

6-(Ethylamino)-4-(3-methoxypropyl)-2H-1,4-benzoxazin-3(4H)-one is a chemical compound characterized by its unique structure, which includes a benzoxazine ring fused with an ethylamino group and a methoxypropyl substituent. This compound typically exhibits properties associated with benzoxazines, such as potential biological activity and stability under various conditions. The presence of the ethylamino group may enhance its solubility and reactivity, while the methoxypropyl group can influence its interaction with biological targets. The compound may be of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory or anticancer activities, although specific biological effects would require empirical investigation. Additionally, its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which could affect its behavior in solution and solid-state. Overall, this compound represents a class of organic molecules that could have diverse applications in pharmaceuticals and materials science.

Formula: C₁₄H₂₀N₂O₃

InChI: InChI=1S/C14H20N2O3/c1-3-15-11-5-6-13-12(9-11)16(7-4-8-18-2)14(17)10-19-13/h5-6,9,15H,3-4,7-8,10H2,1-2H3

InChI key: InChIKey=KZANMCIQRPDHTM-UHFFFAOYSA-N

SMILES: C(CCOC)N1C=2C(=CC=C(NCC)C2)OCC1=O

Synonyms:

• 6-(Ethylamino)-4-(3-methoxypropyl)-2H-1,4-benzoxazin-3(4H)-one
• 2H-1,4-Benzoxazin-3(4H)-one, 6-(ethylamino)-4-(3-methoxypropyl)-

2H-1,4-Benzoxazin-3(4H)-one, 6-(ethylamino)-4-(3-methoxypropyl)-

CAS: 897950-84-4

Formula: C₁₄H₂₀N₂O₃

Molecular weight: 264.3202

Ref: IN-DA003ZO8