CAS 897958-55-3
:α-Amino-1H-pyrrolo[2,3-b]pyridine-3-propanoic acid
Description:
α-Amino-1H-pyrrolo[2,3-b]pyridine-3-propanoic acid, identified by its CAS number 897958-55-3, is a heterocyclic compound featuring a pyrrolopyridine structure. This compound is characterized by the presence of an amino group and a propanoic acid moiety, which contribute to its potential as an amino acid derivative. The pyrrolopyridine framework is notable for its aromaticity and the presence of nitrogen atoms, which can influence its reactivity and interaction with biological systems. This compound may exhibit properties such as solubility in polar solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic pathways. The presence of both an amino group and a carboxylic acid group allows for various chemical modifications, making it a versatile building block in organic synthesis. Overall, α-Amino-1H-pyrrolo[2,3-b]pyridine-3-propanoic acid represents an interesting compound for further research in both synthetic and medicinal chemistry contexts.
Formula:C10H11N3O2
InChI:InChI=1S/C10H11N3O2/c11-8(10(14)15)4-6-5-13-9-7(6)2-1-3-12-9/h1-3,5,8H,4,11H2,(H,12,13)(H,14,15)
InChI key:InChIKey=SNLOIIPRZGMRAB-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)C=1C=2C(NC1)=NC=CC2
Synonyms:- α-Amino-1H-pyrrolo[2,3-b]pyridine-3-propanoic acid
- 1H-Pyrrolo[2,3-b]pyridine-3-propanoic acid, α-amino-, (±)-
- 1H-Pyrrolo[2,3-b]pyridine-3-alanine
- 1H-Pyrrolo[2,3-b]pyridine-3-propanoic acid, α-amino-
- 1H-Pyrrolo[2,3-b]pyridine-3-propionic acid, α-amino-, DL-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
