CAS 89796-20-3
:N-(2-bromoprop-2-en-1-yl)butan-1-amine
Description:
N-(2-bromoprop-2-en-1-yl)butan-1-amine, with the CAS number 89796-20-3, is an organic compound characterized by the presence of both an amine and a brominated alkene functional group. This compound features a butan-1-amine backbone, which contributes to its basicity and potential for nucleophilic reactivity. The presence of the 2-bromoprop-2-en-1-yl group introduces a double bond and a bromine atom, which can enhance its reactivity in various chemical reactions, such as substitution or elimination reactions. The bromine atom can serve as a leaving group, making the compound useful in synthetic organic chemistry. Additionally, the structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the amine and the alkene functionalities. Its physical properties, such as solubility and boiling point, would depend on the specific molecular interactions and the presence of functional groups. Overall, this compound exemplifies the complexity and versatility of organic molecules in chemical synthesis and application.
Formula:C7H14BrN
InChI:InChI=1/C7H14BrN/c1-3-4-5-9-6-7(2)8/h9H,2-6H2,1H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
