CAS 89796-55-4

N-(2-chloroethyl)-3-methoxy-N-methyl-3-oxopropan-1-aminium chloride

Description:

N-(2-chloroethyl)-3-methoxy-N-methyl-3-oxopropan-1-aminium chloride, with the CAS number 89796-55-4, is a quaternary ammonium compound characterized by its unique structure that includes a chloroethyl group and a methoxy group. This compound typically exhibits properties associated with quaternary ammonium salts, such as being soluble in water and having surfactant-like behavior. It may possess antimicrobial or antifungal properties, making it of interest in various applications, including pharmaceuticals and agricultural chemicals. The presence of the oxo group suggests potential reactivity, particularly in nucleophilic substitution reactions. Additionally, the quaternary ammonium structure often leads to cationic behavior, which can influence its interaction with biological membranes and other substances. Safety and handling precautions are essential due to the potential toxicity associated with chlorinated compounds. Overall, this compound's characteristics make it a subject of interest in both research and industrial applications, particularly in fields requiring biocidal or surfactant properties.

Formula: C₇H₁₅Cl₂NO₂

InChI: InChI=1/C7H14ClNO2.ClH/c1-9(6-4-8)5-3-7(10)11-2;/h3-6H2,1-2H3;1H

2-chloroethyl-(2-methoxycarbonylethyl)-methyl-azanium chloride

CAS: 89796-55-4

Formula: C₇H₁₅Cl₂NO₂

Molecular weight: 216.1055

Ref: IN-DA003YGL